answersLogoWhite

0


Best Answer

If both reactants are in aqueous solution, the equation is:

2 NH4Cl + Sr(OH)2 => 2 NH4OH + SrCl2, or, if the pH is sufficiently high in the solution,

2 NH4Cl + Sr(OH)2 => 2 NH3 (g) + 2 H2O + SrCl2

User Avatar

Wiki User

14y ago
This answer is:
User Avatar
More answers
User Avatar

AnswerBot

6mo ago

The balanced equation for the reaction between strontium hydroxide (Sr(OH)2) and ammonium sulfide ((NH4)2S) is:

Sr(OH)2 + (NH4)2S -> SrS + 2 NH3 + 2 H2O

This answer is:
User Avatar

User Avatar

Wiki User

12y ago

Hydrogen Sulfate does not exist by itself. If you mean Sulfuric Acid which is H2SO4

H2SO4(aq) + 2NH4OH(aq) --> (NH4)2SO4(aq) + 2H2O(l)

This answer is:
User Avatar

User Avatar

Wiki User

6y ago

The chemical reaction is:
K2SO4 + Sr(NO3)2 = SrSO4(s) + 2 KNO3

This answer is:
User Avatar

User Avatar

Wiki User

13y ago

Sr(OH)2 + (NH4)2S ---> SrS + 2NH4OH

This answer is:
User Avatar

User Avatar

Wiki User

13y ago

Sr(OH)2+Na2(SO4)=SrSO4+2NaOH

This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is the balanced equation for strontium hydroxide ammonium sulfide?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What is the balanced equation for ammonium hydroxide and perchloric acid?

the balanced equation for ammonium hydroxide and perchloric acid is given below.NH4OH (aq) + HCl (aq) ---> NH4Cl (aq)+ H2O (l) .Above is the balanced molecular Equation.


What is the balanced equation for when ammonium hydroxide decomposes into water and ammonia?

The balanced equation for the decomposition of ammonium hydroxide (NH4OH) into water (H2O) and ammonia (NH3) is: NH4OH -> H2O + NH3


What is the balanced equation for ammonium hydroxide added to hydrobromic acid?

The balanced equation for ammonium hydroxide added to hydrobromic acid is: NH4OH + HBr -> NH4Br + H2O


What is a balanced equation for hydrochloric acid with ammonium hydroxide?

The balanced equation for hydrochloric acid (HCl) with ammonium hydroxide (NH4OH) is: HCl + NH4OH → NH4Cl + H2O.


What is the word equation for ammonium hydroxide by nitric acid?

Ammonium hydroxide and nitric acid yield ammonium nitrate and water.


What is the balanced equation for ammonium sulfate and sodium hydroxide?

The balanced equation for the reaction between ammonium sulfate (NH4)2SO4 and sodium hydroxide NaOH is: (NH4)2SO4 + 2 NaOH -> 2 NH3 + Na2SO4 + 2 H2O


What is the equation of Ammonium carbonate and potassium hydroxide?

The reaction between ammonium carbonate [(NH4)2CO3] and potassium hydroxide (KOH) will form ammonium hydroxide (NH4OH) and potassium carbonate (K2CO3). The balanced equation is: (NH4)2CO3 + 2KOH → 2NH4OH + K2CO3.


What is the balanced equation for sodium hydroxide ammonium nitrate?

The balanced equation for the reaction between sodium hydroxide and ammonium nitrate is: 2 NaOH + NH4NO3 → 2 H2O + NaNO3 + NH3


What is the balanced equation for ammonium phosphate and sodium hydroxide?

The balanced equation for the reaction between ammonium phosphate ((NH4)3PO4) and sodium hydroxide (NaOH) is: (NH4)3PO4 + 3NaOH → 3NH3 + Na3PO4 + 3H2O


Equation of phosphoric acid ammonium hydroxide?

The equation for the reaction between phosphoric acid (H3PO4) and ammonium hydroxide (NH4OH) is: H3PO4 + NH4OH -> (NH4)3PO4 + H2O This balanced equation shows the chemical reaction where phosphoric acid reacts with ammonium hydroxide to form ammonium phosphate and water.


Balanced equation for the reaction of acetic acid and ammonium hydroxide?

CH3COOH+NH4OH turns into H2O+CH3COONH4 have fun with chem


What is the balanced ionic equation for when ammonium sulphate and potassium hydroxide are mixed together?

The balanced ionic equation for mixing ammonium sulfate and potassium hydroxide is: (NH4)2SO4 + 2KOH → 2NH3 + K2SO4 + 2H2O