0
The products of propanol combustion are water and carbon dioxide.
Wiki User
∙ 9y ago
Add your answer:
Earn +20 pts
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is ch2 equals c-ch3-ch2-ch2-ch3?
The molecular formula C6H14 is matched by the structure C-CH3-CH2-CH2-CH3. It represents a linear chain alkane compound called hexane.
What is the proper configuration of a straight chain isomer of hexane?
Ch3-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is the molecular structure of 3-methylpentane?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
What is the structure of 2-methylpentan-3-ol?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is the IUPAC name of CH3-CHNH2-CH2-OH?
The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.
How do you find oxidation number of carbon in CH3-CH2-OH?
The oxidation number of carbon in CH3-CH2-OH can be calculated using the formula: sum of oxidation numbers of all atoms in a neutral compound is zero. In this case, the oxidation number of carbon in CH3-CH2-OH is -2.
What is the structure for c2h6o?
C2H6O could be 1) Ethanol, CH3CH2OH 2) Dimethyl ether, CH3OCH3
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What type of reaction between chlorine and butane?
The reaction between chlorine and butane is a substitution reaction known as free radical halogenation. In this reaction, a hydrogen atom in butane is replaced by a chlorine atom, forming chlorobutane. This reaction occurs in the presence of light or heat to initiate the formation of free radicals.
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
