0
Add your answer:
Earn +20 pts
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is ch2 equals c-ch3-ch2-ch2-ch3?
The molecular formula C6H14 is matched by the structure C-CH3-CH2-CH2-CH3. It represents a linear chain alkane compound called hexane.
What is the proper configuration of a straight chain isomer of hexane?
Ch3-ch2-ch2-ch2-ch2-ch3
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is the molecular structure of 3-methylpentane?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
What is the structure of 2-methylpentan-3-ol?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is the IUPAC name of CH3-CHNH2-CH2-OH?
The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.
How do you find oxidation number of carbon in CH3-CH2-OH?
The oxidation number of carbon in CH3-CH2-OH can be calculated using the formula: sum of oxidation numbers of all atoms in a neutral compound is zero. In this case, the oxidation number of carbon in CH3-CH2-OH is -2.
What is the structure for c2h6o?
C2H6O could be 1) Ethanol, CH3CH2OH 2) Dimethyl ether, CH3OCH3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What are the different types of organic reaction?
The different types of organic reactions include substitution, addition, elimination, oxidation, reduction, condensation, and hydrolysis reactions. These reactions involve the breaking or formation of chemical bonds in organic molecules, resulting in the transformation of reactants into products with different chemical properties.
What is ch2 equals c-ch3-ch2-ch2-ch3?
The molecular formula C6H14 is matched by the structure C-CH3-CH2-CH2-CH3. It represents a linear chain alkane compound called hexane.
