0
Add your answer:
Earn +20 pts
What is the structural formula of methyl methacrylate?
H2C=C(CH3)COOCH3
What is the structural formula of c3h7cooh ch3oh-c3h7cooch3 hoh?
The structural formula of C3H7COOH is CH3CH2COOH (propionic acid). The structural formula of CH3OH-C3H7COOCH3 is CH3OH + CH3CH2COOCH3 (methyl propionate). H2O (water) is produced when these two compounds react together.
Structural formula for p-xylene?
The structural formula for p-xylene is C8H10. It consists of a benzene ring with a methyl group attached to the fourth carbon atom.
What is the condensed structural formula for N-Methylaniline?
The condensed structural formula for N-methylaniline is C7H9N, where the nitrogen atom is attached to a methyl group (-CH3) and a phenyl group (-C6H5) on the benzene ring.
What is the structure of CH3OCH2CH3 hydrocarbon derivatives?
CH3OCH2CH3 is the structural formula for dimethyl ether, an organic compound with the formula CH3OCH3. It consists of a central oxygen atom bonded to two methyl groups.
What is the Structural formula for 3-methyl-1-butene?
structural formula of c5h10
What is the condensed structural formula for methyl acetate?
The condensed structural formula for methyl acetate is CH3COOCH3.
Condensed structural formula of methyl propyl ether?
The condensed structural formula of methyl propyl ether is CH3OCH2CH2CH3.
What is the structural formula for methyl group?
The structural formula for a methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.
Structural formula of 3-chloro 2-methyl 1-butanol?
The structural formula of 3-chloro-2-methyl-1-butanol is CH3CH(Cl)CH(OH)CH2CH3.
What is the structural formula of methyl methacrylate?
H2C=C(CH3)COOCH3
What is the structural formula of c3h7cooh ch3oh-c3h7cooch3 hoh?
The structural formula of C3H7COOH is CH3CH2COOH (propionic acid). The structural formula of CH3OH-C3H7COOCH3 is CH3OH + CH3CH2COOCH3 (methyl propionate). H2O (water) is produced when these two compounds react together.
Structural formula for p-xylene?
The structural formula for p-xylene is C8H10. It consists of a benzene ring with a methyl group attached to the fourth carbon atom.
What what is the structural formula for CH3CH2COCH3?
The structural formula for CH3CH2COCH3, also known as acetone, is CH3-CO-CH2-CH3. It consists of a central carbon atom with a ketone group (C=O) attached to two methyl (CH3) groups on either side.
What is the condensed structural formula for N-Methylaniline?
The condensed structural formula for N-methylaniline is C7H9N, where the nitrogen atom is attached to a methyl group (-CH3) and a phenyl group (-C6H5) on the benzene ring.
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What is the structural formula of acetone?
Acetone: Two Methyl group on two side and a central Carbonyl. H3C-CO-CH3
