Want this question answered?
The CPU is also known as the processor. A processor is the major factor to consider in how fast a computer can process data.
The process of granting a nationality or citizenship to someone is called Naturalization.Naturalization is the process in becoming a citizen.
Inflammatory process: viral or bacterialHypoxiaNeuromuscular impairmentPainMusculoskeletal impairmentTracheobronchial obstructionPerception or cognitive impairmentAnxietyDecreased energy and fatigueDecreased lung expansion
Suffrage is the right to vote gained through the democratic process. This can also be called political franchise, or just plain franchise. Suffrage is often used in terms of elections or representatives, but it can also apply to initiatives and referenda.
That process was called mummification. Not only was it practiced by the Egyptians, it was practiced by the Mayans, the Turks, and even the Chinese!
photolysis
Yes, it is, though debatable, the nose could also be called a passageway, this "organ" is used in the respiratory system, and the process of breathing.
An inward breath is called inhalation. It is the process of breathing in air into the lungs.
respiration
breathing
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
The definition of respiration is the action of breathing. It cab also refer to a process in living organisms involving the production of energy.
The opposite to breathing in
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.
the respritory process
Repiration and Breathing are not the same process. Respiration is converting glucose to useable energy.
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.