0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Is also called the processor?
The CPU is also known as the processor. A processor is the major factor to consider in how fast a computer can process data.
What is the process of becoming a US citizen called?
The process of granting a nationality or citizenship to someone is called Naturalization.Naturalization is the process in becoming a citizen.
What is The Egyptian process of preserving the dead is called?
That process was called mummification. Not only was it practiced by the Egyptians, it was practiced by the Mayans, the Turks, and even the Chinese!
The process that grants immigrants the rights and privileges of citizenship is called?
The process that grants immigrants the rights and privileges of citizenship is called Naturalization.
What is the process of a slave owner releasing his slave called?
The process was called manumission. Prior to the emancipation proclamation, this was sometimes put in an owner's will.
What is the breathing process in plant called?
photolysis
Is the nose is an organ?
Yes, it is, though debatable, the nose could also be called a passageway, this "organ" is used in the respiratory system, and the process of breathing.
What is an inward breath called?
An inward breath is called inhalation. It is the process of breathing in air into the lungs.
The procss of breathing is also called?
respiration
What is the process called when the carbon dioxide leaves the animal?
breathing
What is respiration its not breathing but what is it?
The definition of respiration is the action of breathing. It cab also refer to a process in living organisms involving the production of energy.
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
what is to breath?
The opposite to breathing in
What is the differances between breathing and respiration?
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.
Breathing out is an example of this life process?
the respritory process
Is respiration and breathing same process?
Repiration and Breathing are not the same process. Respiration is converting glucose to useable energy.
What is the difference between respiration and breathing?
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.
