Cyclopentyl ethyl ester
The name of the compound CH3CH2CH2CH3 is butane.
Cyclopentyl ethyl ester
The reaction equation for the hydration of 1-butene with water to form 1-butanol is: CH3CH2CH=CH2 + H2O → CH3CH2CH2CH2OH
The IUPAC name for CH3CH2CH2OCH3 is ethoxyethane.
The compound name of O-CH2-CH3 is ethyl methoxide.
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
The name of the compound CH3CH2CH2CH3 is butane.
This molecule is named propane.
Cyclopentyl ethyl ester
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
The reaction equation for the hydration of 1-butene with water to form 1-butanol is: CH3CH2CH=CH2 + H2O → CH3CH2CH2CH2OH
The IUPAC name for CH3CH2CH2OCH3 is ethoxyethane.
Pentanol
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
pentane
The compound name of O-CH2-CH3 is ethyl methoxide.
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane