0
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);
In those corrected cases the names would be either
- n-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3
- n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
The compound is pentyl propanoate. It consists of a pentyl group (CH3CH2CH2CH2CH2) attached to a propanoate group (CH2CO2CH2CH2CH3).
Add your answer:
Earn +20 pts
What is the organic name of ch3ch2ch2ch2ch2co2ch2ch2ch3?
The organic name of the compound CH3CH2CH2CH2CH2CO2CH2CH2CH3 is octanoic acid.
What is the systematic name of the following compound cuclo?
The systematic name of "cuclo" is not provided. If you provide the complete molecular structure, I can help you determine the systematic name of the compound.
If copper appears in the name of a compound in indicates that the compound comtains?
If copper appears in the name of a compound, it indicates that the compound contains copper as one of its constituent elements. The presence of "copper" in the compound's name signifies the inclusion of copper atoms within the chemical structure of the compound.
What is the compound name for H2S2?
Hydrogen persulphide, or hydrogen di0sulphide. It has the structure 'H-S-S-H'.
What is a solid compound which contains water molecules in its crystalline structure called?
A solid compound that contains water molecules in its crystalline structure is called a hydrate.
What is the organic name of ch3ch2ch2ch2ch2co2ch2ch2ch3?
The organic name of the compound CH3CH2CH2CH2CH2CO2CH2CH2CH3 is octanoic acid.
What is the systematic name of the following compound cuclo?
The systematic name of "cuclo" is not provided. If you provide the complete molecular structure, I can help you determine the systematic name of the compound.
If copper appears in the name of a compound in indicates that the compound comtains?
If copper appears in the name of a compound, it indicates that the compound contains copper as one of its constituent elements. The presence of "copper" in the compound's name signifies the inclusion of copper atoms within the chemical structure of the compound.
What is the compound name for CH3NO?
It is Methanamide with structure: H-(C=O)-NH2
What does the name hydrate indicate about its composition?
The name "hydrate" indicates that the compound contains water molecules attached to its structure. In hydrates, water molecules are typically loosely bound to the compound through hydrogen bonding. The water content can vary, but it is usually expressed as a ratio to the compound in the formula.
What is this compound name S2CI2?
The compound S2Cl2 is known as disulfur dichloride. It is a chemical compound made up of two sulfur atoms and two chlorine atoms, with a bent molecular structure.
What are different kinds of sentence according to structure?
Sentence according to structure are: simple, compound, complex and compound-complex.
How do you find how many atoms of an element are in a compound if you are only given the name and not the formula?
Draw the structure based on the name. Then count the number of times each atom appears in the structure. Alternately, you can determine the formula from the structure - and then count all atoms of each type.
What is the compound name for H2S2?
Hydrogen persulphide, or hydrogen di0sulphide. It has the structure 'H-S-S-H'.
What is the name of the compound S4?
The compound S4 is called sulfur tetramer. It consists of four sulfur atoms bonded together in a ring structure.
Is the chemical name and compound name the same for BaCl2.2H2O?
It's barium chloride, and the 2 water molecules are the water of crystallization necessary to form a crystal lattice structure.
What is a solid compound which contains water molecules in its crystalline structure called?
A solid compound that contains water molecules in its crystalline structure is called a hydrate.
