0
Add your answer:
Earn +20 pts
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the iupac name for ch3 - ch2 - ch2 - sh?
The IUPAC name for the given compound CH3-CH2-CH2-SH is propane-1-thiol.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
How do you name this molecule ch3 ch2 ch3?
This molecule is named propane.
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the iupac name for ch3 - ch2 - ch2 - sh?
The IUPAC name for the given compound CH3-CH2-CH2-SH is propane-1-thiol.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is the reaction equation of 1-butene and water?
The reaction equation for the hydration of 1-butene with water to form 1-butanol is: CH3CH2CH=CH2 + H2O → CH3CH2CH2CH2OH
What is the iupac name for ch3 ch2 ch2 o ch3?
The IUPAC name for CH3CH2CH2OCH3 is ethoxyethane.
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
The molecule is called butane. It consists of four carbon atoms in a chain with each carbon having hydrogen atoms attached, including the end carbons which each have 3 hydrogens.
