0
Add your answer:
Earn +20 pts
What is C2H5OH molecular shape?
The molecular shape of this molecule is made up of two distinct shapes. In CH3-ch2-ch3 the shapes of the first and third carbons is trigonal planar; that of the second carbon is tetrahedral.
What is the secondary amine with the molecular formula C3H9N?
The secondary amine with the molecular formula C3H9N is dimethylamine. It has the chemical structure CH3-NH-CH3, with two methyl groups attached to the nitrogen atom.
What is the molecular shape name for C3H8?
The molecular shape name for C3H8 is a tetrahedron.
What is the molecular shape of ICl?
Parent Shape: Trigonal bipyrimidal Actual shape: Trigonal Planar
What would be the spatial arrangement (shape) of the atoms of the methyl anion CH3-?
The methyl anion, CH3-, has a trigonal pyramidal shape. This means that the three hydrogen atoms are arranged around the carbon atom in a pyramidal shape, with a lone pair of electrons on the top of the pyramid.
What is the molecular shape of CH3?
Trigonal planar.
What is the molecular geometry of CH3 plus?
Trigonal Planar
What is the shape bond angle and hybridization of plus CH3?
CH3 is a trigonal planar and has a hybridization of sp3
What is the molecular formula of CTAB?
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
What is the molecular formula of the Methyl Group?
The molecular formula of the methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.
What is the molecular structure of acetic acid?
CH3-COOH
What is the molecular structure of 3-methylpentane?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na
What is C2H5OH molecular shape?
The molecular shape of this molecule is made up of two distinct shapes. In CH3-ch2-ch3 the shapes of the first and third carbons is trigonal planar; that of the second carbon is tetrahedral.
How much isomers does c5h10 have?
C5H10 can have four isomers: Pentane Isopentane Neopentane Cyclopentane
What is the secondary amine with the molecular formula C3H9N?
The secondary amine with the molecular formula C3H9N is dimethylamine. It has the chemical structure CH3-NH-CH3, with two methyl groups attached to the nitrogen atom.
What is the formula for tertiary alcohol?
molecular formula is C4H10O also written as (CH3)3COH
