0
The given collection of symbols is one way of writing the formula of a straight-chain hydrocarbon with 9 carbon atoms, which has the name "nonane".
More conventionally: all the letters in the formula should be capitalized, since they represent the chemical elements hydrogen and carbon; the numbers should all be subscripts instead of being on the same base as the letters; and there should be a hyphen, representing a chemical bond, between each two groupings written without spaces, where there is now simply a space. The formula can also be written more compactly as H3C(CH2)7CH3.
Still curious? Ask our experts.
Chat with our AI personalities
Fran
Coach
Rene
Add your answer:
Earn +20 pts
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
Is H3C-C-CH2-CH3 A hydrocarbon or a functionalized hydrocarbon?
H3C-C-CH2-CH3 is a hydrocarbon as it consists only of carbon and hydrogen atoms bonded together in a chain without any functional groups attached.
What is H3C-CH2-CH2-CH2-CH3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
What is h3c--c--ch2--ch3?
butonal
What compound is this H3C-H3C-Cl-H-O?
The compound is chloroethanol, also known as 2-chloroethanol. It is an organic compound with the chemical formula C2H5ClO.
