0
The given collection of symbols is one way of writing the formula of a straight-chain hydrocarbon with 9 carbon atoms, which has the name "nonane".
More conventionally: all the letters in the formula should be capitalized, since they represent the chemical elements hydrogen and carbon; the numbers should all be subscripts instead of being on the same base as the letters; and there should be a hyphen, representing a chemical bond, between each two groupings written without spaces, where there is now simply a space. The formula can also be written more compactly as H3C(CH2)7CH3.
Add your answer:
Earn +20 pts
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
Is H3C-C-CH2-CH3 A hydrocarbon or a functionalized hydrocarbon?
H3C-C-CH2-CH3 is a hydrocarbon as it consists only of carbon and hydrogen atoms bonded together in a chain without any functional groups attached.
What is H3C-CH2-CH2-CH2-CH3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
What is h3c--c--ch2--ch3?
butonal
What compound is this H3C-H3C-Cl-H-O?
The compound is chloroethanol, also known as 2-chloroethanol. It is an organic compound with the chemical formula C2H5ClO.
What is h3c-c-ch2-ch3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?
The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
Is H3C-C-CH2-CH3 A hydrocarbon or a functionalized hydrocarbon?
H3C-C-CH2-CH3 is a hydrocarbon as it consists only of carbon and hydrogen atoms bonded together in a chain without any functional groups attached.
What is cl compound?
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
What is H3C-CH2-CH2-CH2-CH3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
What is condensed formula for N-ethyl-N-ethanamide?
The condensed formula for N-ethyl-N-ethanamide is EtNHCH2CH3.
What are the hybridization of the carbon atoms in CH3 CH2 COH?
The C in h3c is sp3 hybridized The c in ch is sp2 hybridized the c in ch2 is sp2 hybridized
Why is it called 3%?
3-heptene indicates that the third carbon atom in the seven-carbon chain has a double bond with the fourth carbon atom. H3C-CH2-CH=CH-CH2-CH2-CH3
What is the correct structure of 3-3-dimethylhexane?
H3c h3c ch3 ch3
Why 3 called 3?
3-heptene indicates that the third carbon atom in the seven-carbon chain has a double bond with the fourth carbon atom. H3C-CH2-CH=CH-CH2-CH2-CH3
