Create
0
Log in
Subjects
>
Science
>
Chemistry
What is 2-2-4-4-tetramethylpentane?
Anonymous
∙
14y ago
Updated: 5/28/2024
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Wiki User
∙
14y ago
Copy
Show More Answers (1)
Add Your Answer
What else can I help you with?
Search
Continue Learning about Chemistry
Related Questions
Trending Questions
What is the chemical equation AlSO4?
How many moles of HCl are represented by 1.0 x 1019 HCl molecules?
Why most mountain climbers often use a supply of oxygen?
How does a scientist make two solutions with same molarity?
What is the weight of a raisin after osmosis?
What are the function of base burette in laboratory?
How did the scientific revolution change the way scentists proved their ideas?
Invention of Alexander Fleming?
What will happen to a silver earring that is accidentally dropped into toilet bowl cleaner that contains hydrochloric acid?
What molecules is like H20 and how is this molecule alike?
Who invented calpol?
What is the Lewis dot structure of CH2Cl?
Is ammonium a metal or a non metal?
What color is ethylene flame?
What is the balanced chemical equation for glycerol?
Does ferrous sulfate have sulfur?
What is the name of the ionic compound Mg3P2?
What is an ion found in all acids?
What happens When acid is added to a solution of pH 7?
How much stronger is pH 9 than pH 4?