Tags Acids and Bases

Animals & Plants Arts & Entertainment Auto Beauty & Health Books and Literature Business Electronics Engineering & Technology Food & Drink History Hobbies Jobs & Education Law & Government Math People & Society Science Social Studies Sports Travel & Places

0

Subjects>Science>Chemistry

Is oleic acid soluble dilute NaOH?

Anonymous

∙ 12y ago

Updated: 5/31/2024

Yes it is. Sodium oleate is formed.

Wiki User

∙ 12y ago

Still curious? Ask our experts.

Chat with our AI personalities

Taiga

Every great hero faces trials, and you—yes, YOU—are no exception!

Chat with Taiga

Coach

Success isn't just about winning—it's about vision, patience, and playing the long game.

Chat with Coach

Devin

I've poured enough drinks to know that people don't always want advice—they just want to talk.

Chat with Devin

More answers

Yes, oleic acid is soluble in dilute NaOH due to the formation of soap through saponification reaction. Oleic acid reacts with NaOH to form the sodium salt of oleic acid, which is a soap that is water-soluble.

AnswerBot

∙ 9mo ago

Add your answer:

Earn +20 pts

Q: Is oleic acid soluble dilute NaOH?

Write your answer...

Submit

Still have questions?

imp

Continue Learning about Chemistry

Is oleic acid soluble in chloroform?

Yes, oleic acid is soluble in chloroform due to its non-polar nature. Chloroform is a non-polar solvent, allowing for the dissolution of non-polar compounds like oleic acid.

Is benzoic acid is soluble in NaOH?

Yes, benzoic acid is soluble in NaOH because when it reacts with NaOH, it forms the water-soluble salt sodium benzoate.

Why is a dilute solution of oleic acid used instead of pure oleic acid?

A dilute solution of oleic acid is used to ensure accuracy and control over the concentration of the acid in experiments or processes. Using a dilute solution allows for easier handling and manipulation of the substance, as well as reducing the risk of potential hazards associated with a concentrated form of oleic acid. Additionally, diluting the acid can help minimize unwanted side reactions or interactions that may occur when using a highly concentrated form.

What type of organic compound dissolves in dilute aqueous NaOH?

Carboxylic acids can typically dissolve in dilute aqueous NaOH due to the formation of water-soluble carboxylate salts. This reaction involves the deprotonation of the carboxylic acid group, resulting in the formation of a carboxylate ion and water.

Is salicylic acid miscible in Naoh nahco3 and Hcl?

Salicylic acid is soluble in NaOH and insoluble in NaHCO3 and HCl. In NaOH, salicylic acid can form a salt through neutralization. In NaHCO3 and HCl, salicylic acid remains as a solid due to its low solubility in these solutions.

Trending Questions

What are differences between photo synthesis and cellular respiration? How do you get marijuana out of you system in 6 hours? What is the normal phase of promethium? What is unique about an azeotropic refrigerant mixture? Is arsenic used in nature? What are the fuel and flux for haematite ore? Where can I buy a cobalt blue napkin holder? How can you change combined chlorine to free available chlorine? Is it possible to get acetic acid to boil at 90 degrees Celsius? What did Dmitri create? What acid use in chloroform? Why does a 4s electron have higher energy than a 3d electron in a chromium atom? Formula of isobutyl formate? How many lone pairs of Br in HBr? Why do you call laugh gas if it does not make you laugh? How many neutrons and protons are in Magnesium 26? Which of the following substances does not produce oxygen gas through decomposition: water, hydrogen peroxide, or potassium chlorate? Is wine a examples of a mixture of liquid and gas? What is the significance of the vinylic carbon in organic chemistry reactions? Which one of the following statements about sulfuric acid is correct A Sulfuric acid is a known muriatic acid B Sulfuric acid is a strong oxidizing agent C Sulfuric acid has little effect on met?

Related Questions

Is oleic acid soluble in sodium hydroxide?

Yes, oleic acid is soluble in sodium hydroxide due to the formation of soap through a saponification reaction. Oleic acid reacts with sodium hydroxide to form sodium oleate, which is a soluble soap compound.

Is oleic acid soluble in chloroform?

Yes, oleic acid is soluble in chloroform due to its non-polar nature. Chloroform is a non-polar solvent, allowing for the dissolution of non-polar compounds like oleic acid.

Is oleic acid soluble in ethyl alcohol?

Yes

Is benzoic acid is soluble in NaOH?

Yes, benzoic acid is soluble in NaOH because when it reacts with NaOH, it forms the water-soluble salt sodium benzoate.

Is dilute acid soluble in water?

Dilute acid is already a solution.

Why is a dilute solution of oleic acid used instead of pure oleic acid?

A dilute solution of oleic acid is used to ensure accuracy and control over the concentration of the acid in experiments or processes. Using a dilute solution allows for easier handling and manipulation of the substance, as well as reducing the risk of potential hazards associated with a concentrated form of oleic acid. Additionally, diluting the acid can help minimize unwanted side reactions or interactions that may occur when using a highly concentrated form.

What type of organic compound dissolves in dilute aqueous NaOH?

Carboxylic acids can typically dissolve in dilute aqueous NaOH due to the formation of water-soluble carboxylate salts. This reaction involves the deprotonation of the carboxylic acid group, resulting in the formation of a carboxylate ion and water.

Is sulfuric acid soluble NaOH?

Sulfuric acid reacts violently with NaOH, producing sodium sulfate and water and lots of heat!

What is the balanced equation for the reaction of oleic acid and sodium hydroxide?

First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20

How do you mix oleic acid with water?

Oleic acid is not soluble in water, so it will not mix directly. To create an emulsion, you can use a surfactant like soap or detergent to help disperse the oleic acid in water. Alternatively, you can first create a solution of oleic acid in an organic solvent like ethanol, then slowly add this solution to water while stirring to form an emulsion.

How do you separate a mixture of oleic acid and solid potassium nitrate and powdered charcoal?

Potassium nitrate is soluble in water, the solution is filtered and evaporated.Oleic acid is soluble in ethanol and separated by filtration and evaporation of the alcohol.

Is salicylic acid miscible in Naoh nahco3 and Hcl?

Salicylic acid is soluble in NaOH and insoluble in NaHCO3 and HCl. In NaOH, salicylic acid can form a salt through neutralization. In NaHCO3 and HCl, salicylic acid remains as a solid due to its low solubility in these solutions.

Still have questions?

imp

Resources

Top Categories

Product

Company

Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.