0
Add your answer:
Earn +20 pts
Is oleic acid soluble in chloroform?
Yes, oleic acid is soluble in chloroform due to its non-polar nature. Chloroform is a non-polar solvent, allowing for the dissolution of non-polar compounds like oleic acid.
Is benzoic acid is soluble in NaOH?
Yes, benzoic acid is soluble in NaOH because when it reacts with NaOH, it forms the water-soluble salt sodium benzoate.
Why is a dilute solution of oleic acid used instead of pure oleic acid?
A dilute solution of oleic acid is used to ensure accuracy and control over the concentration of the acid in experiments or processes. Using a dilute solution allows for easier handling and manipulation of the substance, as well as reducing the risk of potential hazards associated with a concentrated form of oleic acid. Additionally, diluting the acid can help minimize unwanted side reactions or interactions that may occur when using a highly concentrated form.
What type of organic compound dissolves in dilute aqueous NaOH?
Carboxylic acids can typically dissolve in dilute aqueous NaOH due to the formation of water-soluble carboxylate salts. This reaction involves the deprotonation of the carboxylic acid group, resulting in the formation of a carboxylate ion and water.
Is salicylic acid miscible in Naoh nahco3 and Hcl?
Salicylic acid is soluble in NaOH and insoluble in NaHCO3 and HCl. In NaOH, salicylic acid can form a salt through neutralization. In NaHCO3 and HCl, salicylic acid remains as a solid due to its low solubility in these solutions.
Is oleic acid soluble in sodium hydroxide?
Yes, oleic acid is soluble in sodium hydroxide due to the formation of soap through a saponification reaction. Oleic acid reacts with sodium hydroxide to form sodium oleate, which is a soluble soap compound.
Is oleic acid soluble in chloroform?
Yes, oleic acid is soluble in chloroform due to its non-polar nature. Chloroform is a non-polar solvent, allowing for the dissolution of non-polar compounds like oleic acid.
Is oleic acid soluble in ethyl alcohol?
Yes
Is benzoic acid is soluble in NaOH?
Yes, benzoic acid is soluble in NaOH because when it reacts with NaOH, it forms the water-soluble salt sodium benzoate.
Is dilute acid soluble in water?
Dilute acid is already a solution.
Why is a dilute solution of oleic acid used instead of pure oleic acid?
A dilute solution of oleic acid is used to ensure accuracy and control over the concentration of the acid in experiments or processes. Using a dilute solution allows for easier handling and manipulation of the substance, as well as reducing the risk of potential hazards associated with a concentrated form of oleic acid. Additionally, diluting the acid can help minimize unwanted side reactions or interactions that may occur when using a highly concentrated form.
What type of organic compound dissolves in dilute aqueous NaOH?
Carboxylic acids can typically dissolve in dilute aqueous NaOH due to the formation of water-soluble carboxylate salts. This reaction involves the deprotonation of the carboxylic acid group, resulting in the formation of a carboxylate ion and water.
Is sulfuric acid soluble NaOH?
Sulfuric acid reacts violently with NaOH, producing sodium sulfate and water and lots of heat!
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
How do you mix oleic acid with water?
Oleic acid is not soluble in water, so it will not mix directly. To create an emulsion, you can use a surfactant like soap or detergent to help disperse the oleic acid in water. Alternatively, you can first create a solution of oleic acid in an organic solvent like ethanol, then slowly add this solution to water while stirring to form an emulsion.
How do you separate a mixture of oleic acid and solid potassium nitrate and powdered charcoal?
Potassium nitrate is soluble in water, the solution is filtered and evaporated.Oleic acid is soluble in ethanol and separated by filtration and evaporation of the alcohol.
Is salicylic acid miscible in Naoh nahco3 and Hcl?
Salicylic acid is soluble in NaOH and insoluble in NaHCO3 and HCl. In NaOH, salicylic acid can form a salt through neutralization. In NaHCO3 and HCl, salicylic acid remains as a solid due to its low solubility in these solutions.
