0
No, ch3ch is not polar because it is a nonpolar molecule due to the symmetric arrangement of its carbon and hydrogen atoms. The molecule is nonpolar as the electronegativities of carbon and hydrogen are very similar, resulting in no significant charge separation.
Add your answer:
Earn +20 pts
What is the structural formula of 2-pentene?
H3C-CH=CBr-CH2-CH3A 5 carbon chain with a one double bond between the 2nd and 3rd carbon atoms, and a bromine bound to the third carbon in the chain. Implicit hydrogens filled up to 4 bonds per carbon.
What is name of ch3chch3ch2cho?
The name of the compound CH3CH(CH3)CH2CHO is 2-methylbutanal.
What is the name of the compound CH3CH(CH3)C(CH3)?
The compound is called 2,2,3-trimethylbutane.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
Which formula represents 2-butene?
Buthane is a saturated hydrocarbon. That means all the bonds found in this molecule are single covalent bond. Its formula is C4H10. It is the fourth member of the alkane siri.
How many isomers are there of c4h8?
There 4 isomers : 1) H2C=CHCH2CH3 => but-1-ene 2) CH3CH=CHCH3 => but-2-ene 3) (CH3)2C=CHCH3 => 2- methylpropene 4) CH2-CH2-CH2-CH2 => cyclobutane/cycloalkane. C4h8 has 3 isomers from the same homologous series and one that is not from the same homologous series.
Is adenine polar or non polar?
Alanine is an amphoteric substance: both acidic and basic at the same time. However, it is neutral in a pH = 6.1 solution: CH3CH(NH3+)COO- It is positvely charged ( by excess of H+) at lower pH sol'n CH3CH(NH3+)COOH and negatively in pure water or more basic solution CH3CH(NH2)COO-.
What is the structural formula of 2-pentene?
H3C-CH=CBr-CH2-CH3A 5 carbon chain with a one double bond between the 2nd and 3rd carbon atoms, and a bromine bound to the third carbon in the chain. Implicit hydrogens filled up to 4 bonds per carbon.
What is the structure for 3-chlorobutanamide?
CH3CH(Cl)-CH2-CONH2
What is ch3ch?
Many compounds have this formula; for example tert-butylamine.
Sketch a polar curve for r equals sin theta?
It will be a circle.
What kind of reproduction do polar bears use?
polar bears reproduce sexually which mostly uses egg and sperm equals a baby
What is the chemical name for isopropyl alcohol?
Ch3ch(oh)ch3
What is name of ch3chch3ch2cho?
The name of the compound CH3CH(CH3)CH2CHO is 2-methylbutanal.
What is the name of the compound CH3CH(CH3)C(CH3)?
The compound is called 2,2,3-trimethylbutane.
What is condensed structure for 2-butanol?
The condensed structure for 2-butanol is CH3CH(CH3)CH2OH.
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.
