0
Add your answer:
Earn +20 pts
Why 1-hexanol has higher boiling point than 3-hexanol?
1-Hexanol has a higher boiling point than 3-hexanol because 1-hexanol has a straight chain structure that allows for stronger intermolecular interactions such as hydrogen bonding. In contrast, 3-hexanol has a branched chain structure which disrupts the formation of hydrogen bonds, leading to weaker intermolecular forces and a lower boiling point.
Why is 4-hexanol an incorrect name....what is the correct name for this alcohol?
The incorrect name 4-hexanol implies a hexane chain with a primary alcohol group (OH) at the 4th carbon. However, the correct systematic name for this alcohol is 1-hexanol, with the hydroxyl group attached to the first carbon of the hexane chain.
Structural formula of 3-chloro 2-methyl 1-butanol?
The structural formula of 3-chloro-2-methyl-1-butanol is CH3CH(Cl)CH(OH)CH2CH3.
If the are 9 structural isomers of C7H16 how many of these isomers have no secondary hydrogen?
There are a total of three structural isomers of C7H16 that have no secondary hydrogen atoms. These isomers are 2-methylhexane, 3-methylhexane, and 2,2-dimethylpentane.
What are the possible isomers for C6H12O?
There are 5 different carbon backbone structures including benzine that are possible isomers of C6H12O. Of these 5, the benzine ring can only form -OH compounds with the formula C6H12O so there is only one benzine isomer. The linear carbon chain can form 3 different isomers with a double bonded oxygen; an aldehyde and 2 ketones (on the first, second, or third carbon). It can also form 15 different alkene isomers with an -OH functional group (hyrdoxyl) in different positions on the chain and a double bond on the first, second or third carbon in the chain. This gives 18 total possible isomers of C6H12O with the linear 6 carbon chain. There are two variation with a five carbon chain and a methyl group on the second and the third carbon in the chain. There is a 4 carbon chain variation with an ethyl on the second carbon in the chain. Both the five and four carbon chain variations can make different isomers with a double bonded oxygen in various locations and alkene variations with a double bond in the carbon chain and an -OH functional group (hyrdoxyl) in different positions on the chains. Over all there are over 60 different isomers of C6H12O that are possible.
Why 1-hexanol has higher boiling point than 3-hexanol?
1-Hexanol has a higher boiling point than 3-hexanol because 1-hexanol has a straight chain structure that allows for stronger intermolecular interactions such as hydrogen bonding. In contrast, 3-hexanol has a branched chain structure which disrupts the formation of hydrogen bonds, leading to weaker intermolecular forces and a lower boiling point.
Lucas' reagent reaction with 3-methyl-1-hexanol?
In the Lucas reagent test, 3-methyl-1-hexanol would react through an SN1 mechanism where the hydroxyl group is replaced by a chlorine atom, forming 3-chloro-3-methylhexane. The reaction rate depends on the stability of the carbocation intermediate, which for secondary alcohols like 3-methyl-1-hexanol is faster compared to primary alcohols.
Why is 4-hexanol an incorrect name....what is the correct name for this alcohol?
The incorrect name 4-hexanol implies a hexane chain with a primary alcohol group (OH) at the 4th carbon. However, the correct systematic name for this alcohol is 1-hexanol, with the hydroxyl group attached to the first carbon of the hexane chain.
What is structural formula of 3-oxopentanal?
The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.
What is the Structural formula for 3-methyl-1-butene?
structural formula of c5h10
What is the structural formula of 3 pentanone?
Ch3ch2coch2ch3
What are the 3 structural adaptations of chameleon?
eyes skin tongue
What are the types of disequilibrium in bop?
There are 3 types of disequilibrium's in balance of payments:- 1) cyclical disequilibrium 2) secular disequilibrium 3) structural disequilibrium structural disequilibrium at:-a) goods level b) at factors level
What is the structural formula for 3-heptanol?
The structural formula for 3-heptanol is CH3(CH2)5CH(OH)CH3. It has a chain of 7 carbon atoms with a hydroxyl group (OH) attached to the third carbon atom.
What is the unit used for structural efficiency?
There is not supposed to be a unit. Its just a number. Example: the structure can hold 6kg. the structure is 2kg. The Structural efficiency is 3 (no unit)
Are Inherited behaviors that help animals survive are called structural adaptations?
nope there called behavioural adaptations. there are 3 kinds of adaptations: structural behavioural physiological
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
