Tags English Spelling and Pronunciation

Animals & Plants Arts & Entertainment Auto Beauty & Health Books and Literature Business Electronics Engineering & Technology Food & Drink History Hobbies Jobs & Education Law & Government Math People & Society Science Social Studies Sports Travel & Places

0

Subjects>Social Studies>Linguistics

How do you pronounce Syrophoenician?

Updated: 5/1/2024

Wiki User

∙ 11y ago

Best Answer

Siro-Pho-Nicen.. is how it is pronounced you could say pronounce the end half of the word Nician or Nicen. Siro-Pho(Fo)-Nician(nicen)

Wiki User

∙ 11y ago

This answer is:

More answers

AnswerBot

∙ 6mo ago

It is pronounced as suh-roh-fuh-NEE-shuhn.

This answer is:

Add your answer:

Earn +20 pts

Q: How do you pronounce Syrophoenician?

Write your answer...

Submit

Still have questions?

imp

Continue Learning about Linguistics

How do you pronounce girl?

pronounce it as "eat" girl

How do you pronounce qiao?

"Pronounce it as 'chow'."

How do you pronounce trencadis?

pronounce trencadis

How do you pronounce lahote?

"La-hoat" is how you would pronounce "Lahote."

What is a antonym for mispronounce?

The antonym for mispronounce is pronounce correctly.

Related questions

How do you count to 10 in dutch?

een (Pronounce: eyn) twee (Pronounce: twey) drie (Pronounce: dree) vier (Pronounce: veer) vijf (Pronounce: vive) zes (Pronounce: zes) zeven (Pronounce: zeyven acht (Pronounce: acht) negen (Pronounce:neygen) tien (Pronounce: teen)

How do you pronounce Mauis?

You pronounce maui mow-E

How do you pronounce the name ceja?

You pronounce it like this "Say ha" that is how you pronounce Ceja.

How do you pronounce Paige?

You pronounce it as Page.

How do you pronounce frieze?

pronounce it as freez.

How do you pronounce xorge?

You pronounce it gorge

How do you pronounce brynne?

Brin is how you pronounce it

How do you pronounce Baekje?

How do you pronounce Baekje.

How do you pronounce albustix?

Albustix pronounce

How do you pronounce ę?

you pronounce it as ei

How do you pronounce bruchko?

How do you pronounce Bruchko?

How do you pronounce tiga?

In the UK, they pronounce it like 'sugar' while Americans pronounce it like 'tea-aga'.

Trending Questions

What is the word origin for September? What does Chatillon mean in French? Which set of common nouns turns plural by adding 'es'? Is looking a preposition? What is a reflexive compound pronoun? What languages are spoken in the Sonoran desert? How do you say ''my mommy '' in french language? Disadvatages of direct method of language learning? How do you use celebrate in a sentence? What is the name of dandelion root in marathi? How does laziness affect the life of the Filipinos? What is the proper intonation in what's your name? How do you say where do you live in Portuguese? How do you say hi in tagalog? What words have a short e sound but are spelled with a u? What is the homophone for parish? What is an example of a phoneme? What is the interpretation of Three Friends by Yoruba? What is the plural posessive of lady? What is ment by pisciculture?

Still have questions?

imp

Previously Viewed

How do you pronounce Syrophoenician?

Unanswered Questions

What is the largest remainder you can have when you divide by 25? How many pounds of dry cat food will fit in a gallon container? What is 10 percent 127? What is an example of something that is 1 mile? How do you get 7000 points in bartender in mix genius? What is double 19? What is 11 minus 6? How do you write 456702?

Resources

Top Categories

Product

Company

Copyright ©2024 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.